For research use only. Not for therapeutic Use.
5-Methyl-1H-imidazo[4,5-b]pyridine(CAT: L041193) is a fused heterocyclic compound featuring both an imidazole and a pyridine ring, with a methyl group at the 5-position. This structure is significant in medicinal chemistry due to its bioisosteric properties, which allow it to mimic purine bases in nucleic acids and interact with various biological targets. Its unique electronic and structural characteristics make it useful for developing kinase inhibitors, antiviral agents, and anti-inflammatory compounds. Researchers use 5-methyl-1H-imidazo[4,5-b]pyridine as a core scaffold in drug discovery, leveraging its stability and functional versatility to create compounds with improved selectivity and pharmacokinetic profiles.
Catalog Number | L041193 |
CAS Number | 27582-24-7 |
Molecular Formula | C7H7N3 |
Purity | ≥95% |
IUPAC Name | 5-methyl-1H-imidazo[4,5-b]pyridine |
InChI | InChI=1S/C7H7N3/c1-5-2-3-6-7(10-5)9-4-8-6/h2-4H,1H3,(H,8,9,10) |
InChIKey | IANINCNCSTYFSO-UHFFFAOYSA-N |