For research use only. Not for therapeutic Use.
5-Methyl-2-(3-thienyl)pyridine(CAT: L021112) is a high-purity heterocyclic compound with significant relevance in pharmaceutical and chemical research. Featuring a unique pyridine-thiophene structure, it serves as a versatile intermediate in the synthesis of advanced organic molecules and active pharmaceutical ingredients. Its well-defined chemical properties make it an ideal candidate for medicinal chemistry, enabling the exploration of novel therapeutic agents. Additionally, this compound is utilized in developing functional materials and as a building block in complex chemical frameworks. With reliable quality and consistent performance, 5-Methyl-2-(3-thienyl)pyridine is a valuable tool for cutting-edge scientific investigations and innovative drug discovery projects.
CAS Number | 56421-82-0 |
Molecular Formula | C10H9NS |
Purity | ≥95% |
IUPAC Name | 5-methyl-2-thiophen-3-ylpyridine |
InChI | InChI=1S/C10H9NS/c1-8-2-3-10(11-6-8)9-4-5-12-7-9/h2-7H,1H3 |
InChIKey | UXJGBSHKYRDOPU-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C=C1)C2=CSC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |