For research use only. Not for therapeutic Use.
5-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile(Cat No.:L006766). It features a benzonitrile group (C6H5CN) substituted at the 2-position with a boron-containing heterocyclic compound. This compound serves as a valuable building block in organic synthesis, especially in the development of pharmaceuticals and advanced materials. Its unique boron-containing structure makes it essential for Suzuki-Miyaura cross-coupling reactions, a significant tool in the creation of complex organic molecules.
CAS Number | 1116093-68-5 |
Molecular Formula | C14H18BNO2 |
Purity | ≥95% |
IUPAC Name | 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
InChI | InChI=1S/C14H18BNO2/c1-10-6-7-12(11(8-10)9-16)15-17-13(2,3)14(4,5)18-15/h6-8H,1-5H3 |
InChIKey | YPNXTWRHWZOBLW-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |