For research use only. Not for therapeutic Use.
5-Methyl-2’-deoxy Cytidine-d3(Cat No.:R007303) is a high-purity deuterated nucleoside essential for advanced biochemical and pharmaceutical research. Featuring three deuterium atoms, this isotopically labeled compound is crucial for studying DNA methylation, epigenetic modifications, and nucleic acid metabolism. It enhances precision and accuracy in analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for genetic research, drug development, and epigenetic studies, 5-Methyl-2’-deoxy Cytidine-d3 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | R007303 |
CAS Number | 1160707-78-7 |
Synonyms | 4-Amino-1-(4-hydroxy-5-hydroxymethyl-tetrahydro-furan-2-yl)-5-(methyl-d3)-1H-pyrimidin-2-one; 2’-Deoxy-5-(methyl-d3)cytidine; 5-(Methyl-d3)deoxycytidine; ?1-(2-Deoxy-β-D-ribofuranosyl)-5-(methyl-d3)cytosine; |
Molecular Formula | C₁₀H₁₂D₃N₃O₄ |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 4-amino-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(trideuteriomethyl)pyrimidin-2-one |
InChI | InChI=1S/C10H15N3O4/c1-5-3-13(10(16)12-9(5)11)8-2-6(15)7(4-14)17-8/h3,6-8,14-15H,2,4H2,1H3,(H2,11,12,16)/t6-,7+,8+/m0/s1/i1D3 |
InChIKey | LUCHPKXVUGJYGU-BXKFBODDSA-N |
SMILES | [2H]C([2H])([2H])C1=CN(C(=O)N=C1N)[C@H]2C[C@@H]([C@H](O2)CO)O |