For research use only. Not for therapeutic Use.
5-Methyl-2-(pyrrolidin-1-yl)benzoic acid(Cat No.:L007466), is a chemical compound widely used in pharmaceutical research and development. This compound belongs to the class of benzoic acid derivatives, featuring a methyl group at position 5 and a pyrrolidine-1-yl group at position 2 of the benzene ring. Scientists employ this compound as a building block in the synthesis of various biologically active molecules. Its unique structure makes it valuable for designing potential drugs, as it can influence the interactions of the resulting compounds with biological targets.
CAS Number | 689142-42-5 |
Molecular Formula | C12H15NO2 |
Purity | ≥95% |
IUPAC Name | 5-methyl-2-pyrrolidin-1-ylbenzoic acid |
InChI | InChI=1S/C12H15NO2/c1-9-4-5-11(10(8-9)12(14)15)13-6-2-3-7-13/h4-5,8H,2-3,6-7H2,1H3,(H,14,15) |
InChIKey | RZFSNMBESKENTH-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)N2CCCC2)C(=O)O |