For research use only. Not for therapeutic Use.
5-Methyl-2,3-dihydro-1H-inden-1-ol is a bicyclic organic compound featuring an indene core with a hydroxyl group at the 1-position and a methyl group at the 5-position. This compound is commonly used in pharmaceutical research and organic synthesis as an intermediate for developing bioactive molecules and complex chemical structures. Its hydroxyl and methyl groups provide reactive sites for chemical modifications, making it valuable in drug discovery and the synthesis of fine chemicals, contributing to advancements in medicinal chemistry and materials science.
CAS Number | 33781-37-2 |
Molecular Formula | C10H12O |
Purity | ≥95% |
IUPAC Name | 5-methyl-2,3-dihydro-1H-inden-1-ol |
InChI | InChI=1S/C10H12O/c1-7-2-4-9-8(6-7)3-5-10(9)11/h2,4,6,10-11H,3,5H2,1H3 |
InChIKey | LFEMDSQMJJGXAK-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |