For research use only. Not for therapeutic Use.
5-Methyl-3H-pyrazol-3-one(Cat No.:L007349), is a vital heterocyclic compound in organic chemistry. Its molecular structure consists of a pyrazolone ring with a methyl substituent, making it a versatile building block in chemical synthesis. This compound finds applications in pharmaceutical and agrochemical research, where its unique structure allows for diverse functionalization. Additionally, it serves as a key intermediate in the production of various bioactive compounds, including pharmaceuticals and crop protection agents. Researchers utilize its reactivity in multistep organic synthesis, making it a valuable tool for medicinal and agricultural chemistry endeavors.
CAS Number | 3206-39-1 |
Molecular Formula | C4H4N2O |
Purity | ≥95% |
IUPAC Name | 5-methylpyrazol-3-one |
InChI | InChI=1S/C4H4N2O/c1-3-2-4(7)6-5-3/h2H,1H3 |
InChIKey | DOPJNPGPZIJGEZ-UHFFFAOYSA-N |
SMILES | CC1=CC(=O)N=N1 |