Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole
For research use only. Not for therapeutic Use.
5-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole(Cat No.:L007301), is a chemical compound. This compound contains an indazole ring substituted with a methyl group and a boron-containing dioxaborolane moiety. Compounds like this are often used in chemical and pharmaceutical research for various purposes, including drug development, catalysis, and materials science. The specific structure of this compound gives it unique properties, making it valuable in the synthesis of complex molecules and materials. Scientists use compounds with boron-containing groups in the development of new drugs and materials due to their versatility and ability to participate in a wide range of chemical reactions.
CAS Number | 1689539-29-4 |
Molecular Formula | C14H19BN2O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
InChI | InChI=1S/C14H19BN2O2/c1-9-6-7-11-10(8-16-17-11)12(9)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3,(H,16,17) |
InChIKey | MSQCECNPLRLVBQ-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC3=C2C=NN3)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |