For research use only. Not for therapeutic Use.
5-Methyl-5-propyl-2-dioxanone-d3 is a deuterated form of a dioxanone compound, where three hydrogen atoms are replaced with deuterium. This isotopic labeling is particularly useful in NMR spectroscopy and mass spectrometry, allowing for precise tracking and analysis of the compound in chemical and biochemical studies. The deuterium atoms help in studying reaction mechanisms, metabolic pathways, and compound behavior in complex systems. Despite the deuteration, it retains the same chemical properties as the non-deuterated version, making it valuable for research and analytical applications.
Catalog Number | R004553 |
CAS Number | 1184973-36-1 |
Synonyms | Carbonic Acid 2-(Methyl-d3)-2-propyltrimethylene-d3 Ester; NSC 65885-d3; |
Molecular Formula | C8H14O3 |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | 5-propyl-5-(trideuteriomethyl)-1,3-dioxan-2-one |
InChI | InChI=1S/C8H14O3/c1-3-4-8(2)5-10-7(9)11-6-8/h3-6H2,1-2H3/i2D3 |
InChIKey | QPAWSFWKAUAJKW-BMSJAHLVSA-N |
SMILES | CCCC1(COC(=O)OC1)C |