For research use only. Not for therapeutic Use.
5-Methylpyrazine-2-carboxylic acid（Cat No.:R004236）, is a chemical compound with the molecular formula C6H6N2O2. It features a pyrazine ring with a carboxylic acid group (-COOH) attached at the 2nd position. This compound’s structure suggests its potential applications in organic synthesis and as a building block for creating diverse molecules. The presence of the carboxylic acid group on the pyrazine ring can influence its reactivity, making it valuable for preparing specialized compounds used in pharmaceuticals, agrochemicals, and other fine chemicals. Its distinct functional group offers opportunities for various chemical transformations and reactions.
| Catalog Number | R004236 |
| CAS Number | 5521-55-1 |
| Synonyms | 5-Methyl-2-pyrazinoic Acid; 5-Methylpyrazine Carboxylic Acid; 5-Methyl-pyrazinecarboxylic Acid; |
| Molecular Formula | C6H6N2O2 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | 5-methylpyrazine-2-carboxylic acid |
| InChI | InChI=1S/C6H6N2O2/c1-4-2-8-5(3-7-4)6(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | RBYJWCRKFLGNDB-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N=C1)C(=O)O |
