For research use only. Not for therapeutic Use.
5-Methylaminouracil（Cat No.:L007122）, is a chemical compound. It is a derivative of uracil, a nucleobase found in RNA. 5-Methylaminouracil is a key intermediate in the synthesis of various pharmaceuticals and nucleoside analogs. Its unique structure, containing a methylamino group (-NHCH3) at the 5th position of the uracil ring, makes it significant in medicinal chemistry research. Researchers use this compound as a starting material to create modified nucleosides, contributing to the development of antiviral drugs and cancer treatments, and advancing the field of medicinal chemistry.
| Catalog Number | L007122 |
| CAS Number | 7577-92-6 |
| Molecular Formula | C5H7N3O2 |
| Purity | ≥95% |
| IUPAC Name | 5-(methylamino)-1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C5H7N3O2/c1-6-3-2-7-5(10)8-4(3)9/h2,6H,1H3,(H2,7,8,9,10) |
| InChIKey | DYRPKHXNULRIQL-UHFFFAOYSA-N |
| SMILES | CNC1=CNC(=O)NC1=O |
