For research use only. Not for therapeutic Use.
5-Methylcytosine (CAT: I018306)) is a methylated form of cytosine, created by the addition of a methyl group at its 5th carbon via DNA methyltransferases. It is a crucial epigenetic marker involved in regulating gene expression, genomic imprinting, and X-chromosome inactivation. Found predominantly in CpG dinucleotides, 5mC is essential for maintaining genomic stability and proper development. Aberrant methylation patterns are linked to diseases such as cancer and neurological disorders. Widely studied in epigenetics research, 5mC provides insights into DNA methylation mechanisms, chromatin remodeling, and transcriptional regulation, supporting the development of therapies targeting epigenetic dysregulation in various diseases.
CAS Number | 554-01-8 |
Molecular Formula | C₅H₇N₃O |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | 6-amino-5-methyl-1H-pyrimidin-2-one |
InChI | InChI=1S/C5H7N3O/c1-3-2-7-5(9)8-4(3)6/h2H,1H3,(H3,6,7,8,9) |
InChIKey | LRSASMSXMSNRBT-UHFFFAOYSA-N |
SMILES | CC1=C(NC(=O)N=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |