For research use only. Not for therapeutic Use.
5-Methylhexanal (Cat.No:R054528) is an organic compound with a fruity and pungent odor. It is often used in the fragrance and flavor industry to impart sweet, fruity, and green notes to various products. This chemical is valuable for creating unique aromatic profiles in perfumes, cosmetics, and food products.
| CAS Number | 1860-39-5 |
| Synonyms | 5-Methylhexan-1-al; |
| Molecular Formula | C7H14O |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 5-methylhexanal |
| InChI | InChI=1S/C7H14O/c1-7(2)5-3-4-6-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | GEKRISJWBAIIAA-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
