For research use only. Not for therapeutic Use.
5-Methylindan is a polycyclic aromatic hydrocarbon characterized by a methyl group attached to the indan ring system. This compound exhibits interesting chemical properties and has potential applications in organic synthesis and materials science. Its structure allows for various transformations, making it a useful building block in the synthesis of more complex organic molecules. Additionally, 5-methylindan has been studied for its potential biological activities, which may include antioxidant and anti-inflammatory effects, contributing to research in pharmaceuticals and bioactive compounds.
| Catalog Number | R027483 |
| CAS Number | 874-35-1 |
| Synonyms | 2,3-Dihydro-5-methyl-1H-indene; 5-Methylindan; 6-Methylindane |
| Molecular Formula | C10H12 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-methyl-2,3-dihydro-1H-indene |
| InChI | InChI=1S/C10H12/c1-8-5-6-9-3-2-4-10(9)7-8/h5-7H,2-4H2,1H3 |
| InChIKey | RFXBCGVZEJEYGG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CCC2)C=C1 |
