For research use only. Not for therapeutic Use.
5-Methylisoquinoline-1-carbonitrile(Cat No.:L007618), is a chemical compound featuring an isoquinoline ring substituted with a methyl group at the 5-position and a cyano group at the 1-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a key intermediate for the synthesis of diverse organic molecules, especially in drug discovery efforts. Its versatile nature allows for various chemical modifications, making it valuable in the development of new compounds for pharmaceutical applications.
CAS Number | 1367744-24-8 |
Molecular Formula | C11H8N2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 5-methylisoquinoline-1-carbonitrile |
InChI | InChI=1S/C11H8N2/c1-8-3-2-4-10-9(8)5-6-13-11(10)7-12/h2-6H,1H3 |
InChIKey | OPKHNJHNOZCQBQ-UHFFFAOYSA-N |
SMILES | CC1=C2C=CN=C(C2=CC=C1)C#N |