For research use only. Not for therapeutic Use.
5′-methylthioadenosine-13C6(Cat No.:S000442) is a labeled variant of 5′-methylthioadenosine (MTA), where all six carbon atoms are enriched with carbon-13 (13C). This molecule is a naturally occurring nucleoside involved in various biochemical pathways, including polyamine synthesis, methionine recycling, and nucleic acid methylation. MTA plays a role in the regulation of cell growth and differentiation. The incorporation of 13C isotopes makes this compound ideal for tracing and studying its metabolic pathways in detail using techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, providing insights into cellular functions and disease mechanisms.
Catalog Number | S000442 |
CAS Number | 2421187-73-5 |
Molecular Formula | C513C6H15N5O3S |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-((113C)methylsulfanyl(113C)methyl)(2,3,4,5-13C4)oxolane-3,4-diol |
InChI | InChI=1S/C11H15N5O3S/c1-20-2-5-7(17)8(18)11(19-5)16-4-15-6-9(12)13-3-14-10(6)16/h3-5,7-8,11,17-18H,2H2,1H3,(H2,12,13,14)/t5-,7-,8-,11-/m1/s1/i1+1,2+1,5+1,7+1,8+1,11+1 |
InChIKey | WUUGFSXJNOTRMR-TWZNKHQZSA-N |
SMILES | CSCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O |