5-Methyluridine-2’-13C is a stable isotope-labeled nucleoside, featuring a 13C atom at the 2’ position. This high-purity compound is crucial for advanced biochemical and pharmaceutical research, particularly in studying nucleic acid metabolism and RNA-related processes. It provides precise and reliable analytical results, enhancing the accuracy of metabolic and pharmacokinetic studies. Ideal for research involving nucleotide synthesis and RNA function, 5-Methyluridine-2’-13C integrates seamlessly into experimental protocols, offering a robust solution for detailed molecular investigations.
| Catalog Number | R041381 |
| CAS Number | 478510-98-4 |
| Synonyms | Ribothymidine-2’-13C; |
| Molecular Formula | C10H14N2O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChI | InChI=1S/C10H14N2O6/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1/i7+1 |
| InChIKey | DWRXFEITVBNRMK-FOMPHFHGSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
