For research use only. Not for therapeutic Use.
5-Methyluridine-5’-13C is a labeled nucleoside where the 5’ carbon of the ribose sugar is enriched with the carbon-13 isotope. This modification does not alter the chemical properties of 5-methyluridine but makes it useful in various biochemical and structural studies. The presence of carbon-13 allows for precise tracking in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, aiding in the investigation of RNA structure, metabolism, and interactions in biological systems. It is particularly valuable in isotopic labeling experiments.
CAS Number | 478511-02-3 |
Synonyms | Ribothymidine-5’-13C; |
Molecular Formula | C10H14N2O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
InChI | InChI=1S/C10H14N2O6/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1/i3+1 |
InChIKey | DWRXFEITVBNRMK-DJLCBFSESA-N |
SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |