For research use only. Not for therapeutic Use.
5-(N-Ethyl-N-2-hydroxyethylamino)-2-pentylamine(CAT: R062214) is a compound with a unique structure that may have implications across various scientific disciplines. The presence of both ethyl and hydroxyethyl groups attached to the pentylamine backbone suggests potential reactivity and functionalization possibilities. This compound could be used as a building block in the synthesis of more complex molecules with tailored properties or functionalities. Its structural features also make it relevant in studies involving structure-activity relationships or drug design.
CAS Number | 69559-11-1 |
Synonyms | 2-[(4-Aminopentyl)ethylamino]-ethanol; (±)-2-[(4-Aminopentyl)ethylamino]ethanol; 5-[N-Ethyl-N-(2-hydroxyethyl)amino]-2-aminopentane; N-Ethyl-N-(2-hydroxyethyl)-4-aminopentylamine |
Molecular Formula | C9H22N2O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-[4-aminopentyl(ethyl)amino]ethanol |
InChI | InChI=1S/C9H22N2O/c1-3-11(7-8-12)6-4-5-9(2)10/h9,12H,3-8,10H2,1-2H3 |
InChIKey | XUVXSSOPXQRCGL-UHFFFAOYSA-N |
SMILES | CCN(CCCC(C)N)CCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |