Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-Nitro-1H-benzo[d]imidazole-2-carboxylic acid
For research use only. Not for therapeutic Use.
5-Nitro-1H-benzo[d]imidazole-2-carboxylic acid is a benzoimidazole derivative featuring a nitro group at the 5-position and a carboxylic acid functional group at the 2-position. This compound is commonly utilized in medicinal and organic chemistry as a precursor in synthesizing various bioactive molecules. Its unique structure allows for targeted modifications, making it valuable in drug discovery and materials science. With stability and reactivity, 5-Nitro-1H-benzo[d]imidazole-2-carboxylic acid serves as an essential building block for complex chemical synthesis.
Catalog Number | L043206 |
CAS Number | 73903-18-1 |
Molecular Formula | C8H5N3O4 |
Purity | ≥95% |
IUPAC Name | 6-nitro-1H-benzimidazole-2-carboxylic acid |
InChI | InChI=1S/C8H5N3O4/c12-8(13)7-9-5-2-1-4(11(14)15)3-6(5)10-7/h1-3H,(H,9,10)(H,12,13) |
InChIKey | GSEMJEXTHJEELQ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=N2)C(=O)O |