For research use only. Not for therapeutic Use.
5-Nitro-1H-indole-3-carbaldehyde(Cat No.:L038880)is an important organic compound used in pharmaceutical and chemical research. Featuring a nitro group at the 5-position and a formyl group at the 3-position of the indole ring, this compound is a key intermediate in the synthesis of complex molecules. It is particularly valuable in the development of new drugs and biologically active compounds, offering versatile chemical reactivity for diverse modifications. 5-Nitro-1H-indole-3-carbaldehyde plays a significant role in advancing medicinal chemistry and high-precision organic synthesis.
CAS Number | 6625-96-3 |
Molecular Formula | C9H6N2O3 |
Purity | ≥95% |
IUPAC Name | 5-nitro-1H-indole-3-carbaldehyde |
InChI | InChI=1S/C9H6N2O3/c12-5-6-4-10-9-2-1-7(11(13)14)3-8(6)9/h1-5,10H |
InChIKey | PHKYMSLVWLYDKP-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CN2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |