For research use only. Not for therapeutic Use.
5-Nitro-7H-pyrrolo[2,3-d]pyrimidin-4-ol(CAT: L043685) is a nitrogen-containing heterocyclic compound featuring a nitro group and a hydroxyl functional group on a pyrrolopyrimidine core. This compound is valuable in medicinal chemistry for its potential bioactivity, often being explored in the development of enzyme inhibitors, antimicrobial agents, or anticancer compounds. The nitro group can modulate electronic properties, enhancing binding interactions in target proteins, while the pyrrolopyrimidine scaffold is a common structure in kinase inhibitors and other pharmacologically relevant compounds. 5-Nitro-7H-pyrrolo[2,3-d]pyrimidin-4-ol serves as a versatile intermediate or lead compound in drug discovery, supporting research in oncology and infectious disease treatment.
CAS Number | 22277-00-5 |
Molecular Formula | C6H4N4O3 |
Purity | ≥95% |
IUPAC Name | 5-nitro-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
InChI | InChI=1S/C6H4N4O3/c11-6-4-3(10(12)13)1-7-5(4)8-2-9-6/h1-2H,(H2,7,8,9,11) |
InChIKey | VDLCETUYKIWGEC-UHFFFAOYSA-N |