For research use only. Not for therapeutic Use.
5-Nitrobenzothiazole-2-thiol(Cat No.:L043987)is a chemically active compound characterized by a benzothiazole ring substituted with a nitro group and a thiol group. This configuration provides the molecule with distinctive properties useful in various applications, including as a building block in organic synthesis and in materials science. The nitro group enhances its electrophilic properties, facilitating aromatic substitution reactions, while the thiol group allows for binding to metals, making it useful in the development of coordination complexes and as a corrosion inhibitor. Its potential in pharmaceutical contexts is also explored, particularly in designing compounds with antimicrobial activity.
CAS Number | 58759-63-0 |
Molecular Formula | C7H4N2O2S2 |
Purity | ≥95% |
IUPAC Name | 5-nitro-3H-1,3-benzothiazole-2-thione |
InChI | InChI=1S/C7H4N2O2S2/c10-9(11)4-1-2-6-5(3-4)8-7(12)13-6/h1-3H,(H,8,12) |
InChIKey | NFZDOFMXGCPMCX-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=S)S2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |