For research use only. Not for therapeutic Use.
5-Nitroquinoline is a heterocyclic compound containing a quinoline ring with a nitro group attached at the 5-position. It finds application as a precursor in organic synthesis for producing pharmaceuticals, dyes, and agrochemicals. Additionally, derivatives of 5-nitroquinoline display biological activity and are studied for potential pharmacological applications, including antimicrobial, antiviral, and anticancer properties. This compound contributes to advancements in medicinal chemistry and drug discovery research.
Catalog Number | R070827 |
CAS Number | 607-34-1 |
Molecular Formula | C9H6N2O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 5-nitroquinoline |
InChI | InChI=1S/C9H6N2O2/c12-11(13)9-5-1-4-8-7(9)3-2-6-10-8/h1-6H |
InChIKey | NDDZXHOCOKCNBM-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC=N2)C(=C1)[N+](=O)[O-] |