For research use only. Not for therapeutic Use.
5-Nitrothiazole-2-carboxylic acid(CAT: L010539) is a high-purity compound commonly used in pharmaceutical and chemical research. Featuring a nitro-substituted thiazole ring and a carboxylic acid group, it serves as a versatile intermediate in the synthesis of bioactive molecules, including antimicrobial agents and enzyme inhibitors. Its functional groups enable diverse chemical reactions, such as coupling, esterification, and amide formation, facilitating the development of novel derivatives. With its reliable reactivity and consistent performance, 5-Nitrothiazole-2-carboxylic acid is a valuable tool for advancing drug discovery and exploring innovative pathways in organic synthesis.
CAS Number | 39920-61-1 |
Molecular Formula | C4H2N2O4S |
Purity | ≥95% |
IUPAC Name | 5-nitro-1,3-thiazole-2-carboxylic acid |
InChI | InChI=1S/C4H2N2O4S/c7-4(8)3-5-1-2(11-3)6(9)10/h1H,(H,7,8) |
InChIKey | KNAAFBMBMBMZHI-UHFFFAOYSA-N |
SMILES | C1=C(SC(=N1)C(=O)O)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |