For research use only. Not for therapeutic Use.
5-(N,N-Dimethyl)-Amiloride Hydrochloride(CAT: M050421) is a derivative of amiloride, known for its role as an inhibitor of sodium-hydrogen exchangers (NHEs) and Na+/Ca2+ exchangers. This compound is widely used in research for its ability to block cellular ion transport mechanisms, particularly in studies of cell volume regulation, pH homeostasis, and intracellular calcium signaling. 5-(N,N-Dimethyl)-Amiloride Hydrochloride is valuable for exploring the mechanisms of various physiological and pathological processes, including cancer metastasis, cardiac ischemia, and neurodegenerative diseases. Its selective inhibition of ion channels makes it a crucial tool in cellular and molecular biology research.
CAS Number | 1214-79-5 |
Molecular Formula | C8H13Cl2N7O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-amino-6-chloro-N-(diaminomethylidene)-5-(dimethylamino)pyrazine-2-carboxamide;hydrochloride |
InChI | InChI=1S/C8H12ClN7O.ClH/c1-16(2)6-4(9)13-3(5(10)14-6)7(17)15-8(11)12;/h1-2H3,(H2,10,14)(H4,11,12,15,17);1H |
InChIKey | IIUPTHVVXMBJMQ-UHFFFAOYSA-N |
SMILES | CN(C)C1=NC(=C(N=C1Cl)C(=O)N=C(N)N)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |