For research use only. Not for therapeutic Use.
5′-O-TBDMS-dU can be used in the synthesis of oligoribonucleotides[1].
| Catalog Number | I044607 |
| CAS Number | 76223-04-6 |
| Synonyms | 1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| Molecular Formula | C15H26N2O5Si |
| Purity | ≥95% |
| InChI | InChI=1S/C15H26N2O5Si/c1-15(2,3)23(4,5)21-9-11-10(18)8-13(22-11)17-7-6-12(19)16-14(17)20/h6-7,10-11,13,18H,8-9H2,1-5H3,(H,16,19,20)/t10-,11+,13+/m0/s1 |
| InChIKey | HCSHWGNMXQKRCF-DMDPSCGWSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C(CC(O1)N2C=CC(=O)NC2=O)O |
| Reference | [1]. Moharram S, et, al. Design and synthesis of 3′- and 5′-O-(3-benzenesulfonylfuroxan-4-yl)-2′-deoxyuridines: biological evaluation as hybrid nitric oxide donor-nucleoside anticancer agents. J Med Chem. 2004 Mar 25;47(7):1840-6. |
