For research use only. Not for therapeutic Use.
5-Oxa-2,7-diazaspiro[3.4]octan-6-one is a spirocyclic compound with an oxygen and two nitrogen atoms integrated within a compact eight-membered ring structure. This heterocyclic compound is widely used as a building block in medicinal and organic chemistry due to its structural rigidity and potential for bioactivity. Its unique framework allows for selective functionalization, making it valuable in synthesizing pharmaceuticals and complex organic molecules. Known for stability, it supports efficient synthesis pathways in drug discovery and advanced material applications.
CAS Number | 1446355-49-2 |
Molecular Formula | C5H8N2O2 |
Purity | ≥95% |
IUPAC Name | 5-oxa-2,7-diazaspiro[3.4]octan-6-one |
InChI | InChI=1S/C5H8N2O2/c8-4-7-3-5(9-4)1-6-2-5/h6H,1-3H2,(H,7,8) |
InChIKey | JOSUSMBJSISVHN-UHFFFAOYSA-N |
SMILES | C1C2(CN1)CNC(=O)O2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |