Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 5-(Piperidin-1-yl)nicotinic acid
For research use only. Not for therapeutic Use.
5-(Piperidin-1-yl)nicotinic acid (Cat.No:L032993) is a chemical compound with potential pharmaceutical applications. Its structure combines a piperidine ring and a nicotinic acid moiety. This compound may have therapeutic significance due to its interaction with nicotinic acid receptors. Further research aims to explore its pharmacological properties and potential clinical uses.
Catalog Number | L032993 |
CAS Number | 878742-33-7 |
Molecular Formula | C11H14N2O2 |
Purity | ≥95% |
IUPAC Name | 5-piperidin-1-ylpyridine-3-carboxylic acid |
InChI | InChI=1S/C11H14N2O2/c14-11(15)9-6-10(8-12-7-9)13-4-2-1-3-5-13/h6-8H,1-5H2,(H,14,15) |
InChIKey | UWDWYCKLOPCIOM-UHFFFAOYSA-N |