For research use only. Not for therapeutic Use.
5-(Piperidin-1-yl)pentanoic acid hydrochloride(Cat No.:L007424), is a chemical compound commonly used in organic synthesis and pharmaceutical research. This compound contains a piperidine ring, a five-carbon aliphatic chain, and a carboxylic acid group. The hydrochloride salt form enhances its stability and solubility in aqueous solutions, making it suitable for various chemical reactions and biological studies.
CAS Number | 49637-20-9 |
Molecular Formula | C10H20ClNO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 5-piperidin-1-ylpentanoic acid;hydrochloride |
InChI | InChI=1S/C10H19NO2.ClH/c12-10(13)6-2-5-9-11-7-3-1-4-8-11;/h1-9H2,(H,12,13);1H |
InChIKey | DHPWBXBFXOJSNL-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)CCCCC(=O)O.Cl |