For research use only. Not for therapeutic Use.
5-(Propan-2-yl)thiophene-2-carboxylic acid(Cat No.:L007539), is a chemical compound with a molecular structure containing a thiophene ring substituted with a carboxylic acid group at the 2nd position and an isopropyl group at the 5th position. This compound is significant in organic synthesis and medicinal chemistry, often utilized as an intermediate or building block for the synthesis of various organic molecules, including pharmaceuticals and agrochemicals. Its versatile reactivity allows for diverse transformations, making it valuable for the creation of complex organic compounds.
CAS Number | 29481-42-3 |
Molecular Formula | C8H10O2S |
Purity | ≥95% |
IUPAC Name | 5-propan-2-ylthiophene-2-carboxylic acid |
InChI | InChI=1S/C8H10O2S/c1-5(2)6-3-4-7(11-6)8(9)10/h3-5H,1-2H3,(H,9,10) |
InChIKey | UNRLIVDGCWAZQO-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC=C(S1)C(=O)O |