For research use only. Not for therapeutic Use.
5-Propylindoline-2,3-dione(CAT: L025651), also known as 5-propylisatin, is an indoline derivative featuring a propyl group at position 5 and a dione (ketone) functional group at positions 2 and 3 of the indoline ring. Indoline-2,3-diones, like isatin and its derivatives, are of significant interest in organic and medicinal chemistry due to their biological activity and role as intermediates in the synthesis of various pharmaceuticals. This compound’s core structure is involved in potential applications, including the development of anti-cancer, anti-inflammatory, and anti-viral drugs, as well as other bioactive molecules. The propyl substitution may influence its lipophilicity and overall bioactivity.
CAS Number | 131609-60-4 |
Molecular Formula | C11H11NO2 |
Purity | ≥95% |
IUPAC Name | 5-propyl-1H-indole-2,3-dione |
InChI | InChI=1S/C11H11NO2/c1-2-3-7-4-5-9-8(6-7)10(13)11(14)12-9/h4-6H,2-3H2,1H3,(H,12,13,14) |
InChIKey | FBYONXZHXASRNB-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |