For research use only. Not for therapeutic Use.
5-(Pyridin-2-yl)-4H-1,2,4-triazol-3-amine(Cat No.:L007135), is a chemical compound with the molecular formula C7H7N5. It consists of a triazole ring, a five-membered heterocyclic structure containing nitrogen atoms, with a pyridine-2-yl group attached at the 5th position and an amine group (-NH2) at the 3rd position. This compound is significant in medicinal chemistry research, often used as a key intermediate in the synthesis of various pharmaceuticals and biologically active molecules. Its unique structure and reactivity make it valuable in drug discovery, enabling the creation of specialized drugs and contributing to advancements in pharmaceutical research and development.
CAS Number | 83417-23-6 |
Molecular Formula | C7H7N5 |
Purity | ≥95% |
IUPAC Name | 5-pyridin-2-yl-1H-1,2,4-triazol-3-amine |
InChI | InChI=1S/C7H7N5/c8-7-10-6(11-12-7)5-3-1-2-4-9-5/h1-4H,(H3,8,10,11,12) |
InChIKey | VPTQEOQBSABCKV-UHFFFAOYSA-N |
SMILES | C1=CC=NC(=C1)C2=NC(=NN2)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |