For research use only. Not for therapeutic Use.
5-(Pyridin-2-yldisulfanyl)pentanoic acid(CAT: L000573) is a compound of significance in organic chemistry and pharmaceutical research. This chemical serves as a key intermediate for the synthesis of various organic molecules, particularly in the development of pharmaceuticals and bioactive compounds. Its unique structure, incorporating a pyridine disulfide group and a pentanoic acid moiety, offers opportunities for structural modification and the creation of novel drugs with potential therapeutic benefits.
CAS Number | 250266-80-9 |
Molecular Formula | C10H13NO2S2 |
Purity | ≥95% |
IUPAC Name | 5-(pyridin-2-yldisulfanyl)pentanoic acid |
InChI | InChI=1S/C10H13NO2S2/c12-10(13)6-2-4-8-14-15-9-5-1-3-7-11-9/h1,3,5,7H,2,4,6,8H2,(H,12,13) |
InChIKey | RKFJMYDHLLROQP-UHFFFAOYSA-N |