For research use only. Not for therapeutic Use.
5-(Pyridin-3-yl)-1,3,4-oxadiazole-2-thiol(Cat No.:L007136), is a chemical compound with the molecular formula C8H5N3OS. It contains an oxadiazole ring, a five-membered heterocyclic structure with nitrogen, oxygen, and sulfur atoms, substituted with a pyridine-3-yl group at the 5th position. This compound is valuable in medicinal chemistry and drug discovery research, frequently utilized in the development of biologically active molecules. Its unique structure makes it significant for potential pharmaceutical applications, as it serves as a scaffold for creating novel drugs, contributing to advancements in areas such as oncology, neuroscience, and other therapeutic fields within the pharmaceutical industry.
CAS Number | 3690-46-8 |
Molecular Formula | C7H5N3OS |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 5-pyridin-3-yl-3H-1,3,4-oxadiazole-2-thione |
InChI | InChI=1S/C7H5N3OS/c12-7-10-9-6(11-7)5-2-1-3-8-4-5/h1-4H,(H,10,12) |
InChIKey | QBLWWQDTKCIRSW-UHFFFAOYSA-N |
SMILES | C1=CC(=CN=C1)C2=NNC(=S)O2 |