For research use only. Not for therapeutic Use.
5-(Pyridin-4-ylmethoxy)isophthalic acid (Cat.No:L003872) is a vital compound in pharmaceutical research. Its distinct structure, incorporating a pyridinylmethoxy group, imparts specialized reactivity and properties. This compound is employed as a key intermediate in the synthesis of pharmacologically active molecules, highlighting its importance in drug development.
CAS Number | 1240327-15-4 |
Molecular Formula | C14H11NO5 |
Purity | ≥95% |
IUPAC Name | 5-(pyridin-4-ylmethoxy)benzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C14H11NO5/c16-13(17)10-5-11(14(18)19)7-12(6-10)20-8-9-1-3-15-4-2-9/h1-7H,8H2,(H,16,17)(H,18,19) |
InChIKey | ANYWVTSQEOSVIU-UHFFFAOYSA-N |
SMILES | C1=CN=CC=C1COC2=CC(=CC(=C2)C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |