For research use only. Not for therapeutic Use.
5-tert-Butyl-2-oxazolecarboxylic is a Aromatic Heterocyclic Carboxylic Acids. It is probably synthesized from enamine, and we can produce its analogues through the same synthetic route. This product is used for scientific research purposes such as organic synthesis and pharmaceutical research and other scientific purposes.
| Catalog Number | R019071 |
| CAS Number | 209531-11-3 |
| Synonyms | 5-(1,1-Dimethylethyl)-2-oxazolecarboxylic Acid |
| Molecular Formula | C8H11NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-tert-butyl-1,3-oxazole-2-carboxylic acid |
| InChI | InChI=1S/C8H11NO3/c1-8(2,3)5-4-9-6(12-5)7(10)11/h4H,1-3H3,(H,10,11) |
| InChIKey | VBNWSGXUJZAXOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN=C(O1)C(=O)O |
