For research use only. Not for therapeutic Use.
5-Trifluoromethyl-1H-pyrazole-3-carboxylic acid(Cat No.:M117064)is a heterocyclic compound featuring a trifluoromethyl group attached to a pyrazole ring, with a carboxylic acid functional group at the 3-position. This compound is an important intermediate in pharmaceutical and agrochemical synthesis, used to introduce the pyrazole moiety into more complex molecules. The trifluoromethyl group enhances the molecule’s stability, lipophilicity, and biological activity, making it valuable in drug design. Its versatility in organic synthesis makes it a crucial building block for developing novel therapeutic agents and other bioactive compounds.
CAS Number | 129768-28-1 |
Molecular Formula | C5H3F3N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid |
InChI | InChI=1S/C5H3F3N2O2/c6-5(7,8)3-1-2(4(11)12)9-10-3/h1H,(H,9,10)(H,11,12) |
InChIKey | CIVNBJPTGRMGRS-UHFFFAOYSA-N |
SMILES | C1=C(NN=C1C(=O)O)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |