For research use only. Not for therapeutic Use.
5-(Trifluoromethyl)thiophene-2-sulfonyl chloride(CAT: L011995) is a reactive organosulfur compound widely utilized in pharmaceutical, agrochemical, and material science research. Featuring a trifluoromethyl group on a thiophene ring and a sulfonyl chloride functionality, it serves as a versatile reagent for the synthesis of sulfonamides, sulfonyl-containing heterocycles, and other bioactive molecules. Its unique structure facilitates the exploration of structure-activity relationships (SAR) in drug discovery and the development of advanced materials. With high purity and reactivity, 5-(Trifluoromethyl)thiophene-2-sulfonyl chloride supports innovative research in medicinal chemistry and synthetic organic chemistry.
CAS Number | 954377-22-1 |
Molecular Formula | C5H2ClF3O2S2 |
Purity | ≥95% |
IUPAC Name | 5-(trifluoromethyl)thiophene-2-sulfonyl chloride |
InChI | InChI=1S/C5H2ClF3O2S2/c6-13(10,11)4-2-1-3(12-4)5(7,8)9/h1-2H |
InChIKey | PWVUZSSHOGAMPC-UHFFFAOYSA-N |
SMILES | C1=C(SC(=C1)S(=O)(=O)Cl)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |