For research use only. Not for therapeutic Use.
5-Uridineacetic acid is a nucleotide derivative with a uridine base linked to an acetic acid moiety. This compound is significant in biochemical research, particularly in studying nucleic acid metabolism and the synthesis of RNA. Its unique structure facilitates investigations into cellular processes, making it valuable in the development of therapeutic agents and the exploration of genetic regulation mechanisms.
| Catalog Number | R028504 |
| CAS Number | 20964-06-1 |
| Synonyms | 5-Carboxymethyluridine; |
| Molecular Formula | C11H14N2O8 |
| Purity | ≥95% |
| Target | Nucleoside Antimetabolite/Analog |
| Storage | -20°C |
| IUPAC Name | 2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]acetic acid |
| InChI | InChI=1S/C11H14N2O8/c14-3-5-7(17)8(18)10(21-5)13-2-4(1-6(15)16)9(19)12-11(13)20/h2,5,7-8,10,14,17-18H,1,3H2,(H,15,16)(H,12,19,20)/t5-,7-,8-,10-/m1/s1 |
| InChIKey | FAWQJBLSWXIJLA-VPCXQMTMSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)CC(=O)O |
