For research use only. Not for therapeutic Use.
5,11-Bis(phenylsulfonyl)dibenzo[a,e]cyclooctene (Cat.No:L003682) is a significant chemical compound in organic synthesis. Its unique fused-ring structure, adorned with phenylsulfonyl groups, imparts distinctive reactivity. This compound is employed as a key reagent in the construction of complex organic molecules and serves as a versatile scaffold in the development of specialized materials. Its applications span various fields, making it a pivotal component in contemporary chemical research and the synthesis of advanced materials.
CAS Number | 468751-39-5 |
Molecular Formula | C28H20O4S2 |
Purity | ≥95% |
IUPAC Name | (2E,10E)-2,10-bis(benzenesulfonyl)tricyclo[10.4.0.04,9]hexadeca-1(16),2,4,6,8,10,12,14-octaene |
InChI | InChI=1S/C28H20O4S2/c29-33(30,23-13-3-1-4-14-23)27-19-21-11-8-10-18-26(21)28(20-22-12-7-9-17-25(22)27)34(31,32)24-15-5-2-6-16-24/h1-20H/b21-19?,22-20?,27-19+,27-25?,28-20+,28-26? |
InChIKey | YDDRLHCYJIKTHQ-LUJQYLPZSA-N |
SMILES | C1=CC=C(C=C1)S(=O)(=O)/C/2=C/C3=CC=CC=C3/C(=CC4=CC=CC=C24)/S(=O)(=O)C5=CC=CC=C5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |