For research use only. Not for therapeutic Use.
5,15-DPP(CAT: I011806) is a synthetic small molecule that acts as an allosteric modulator of the voltage-gated sodium channel Nav1.7. Nav1.7 is predominantly expressed in sensory neurons and plays a key role in pain signaling. By binding to a specific site on the Nav1.7 channel, 5,15-DPP enhances its activity and promotes the opening of the channel. This property of 5,15-DPP has potential therapeutic applications in the development of new pain medications.
| Catalog Number | I011806 |
| CAS Number | 22112-89-6 |
| Synonyms | 5,15-diphenyl-21H,23H-porphine |
| Molecular Formula | C32H22N4 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 10,20-diphenyl-21,22-dihydroporphyrin |
| InChI | InChI=1S/C32H22N4/c1-3-7-21(8-4-1)31-27-15-11-23(33-27)19-25-13-17-29(35-25)32(22-9-5-2-6-10-22)30-18-14-26(36-30)20-24-12-16-28(31)34-24/h1-20,33,35H |
| InChIKey | QIBKIAFNCVIIMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=CC4=CC=C(N4)C(=C5C=CC(=N5)C=C6C=CC2=N6)C7=CC=CC=C7)N3 |
