For research use only. Not for therapeutic Use.
5,4”-Dihydroxy-6,7,8-trimethoxyflavone（Cat No.:M084894） is a specific type of flavonoid, a class of plant-based polyphenolic compounds known for their antioxidant properties. This particular flavone structure is characterized by hydroxy groups at the 5th and 4” positions and methoxy groups at the 6th, 7th, and 8th positions. These functional groups enhance its solubility and increase its potential bioactivity. Flavones like this are studied for their health-promoting effects, including anti-inflammatory, anticancer, and cardioprotective activities. They are often found in various fruits and vegetables and used in traditional medicine and dietary supplements.
| Catalog Number | M084894 |
| CAS Number | 16545-23-6 |
| Molecular Formula | C18H16O7 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-6,7,8-trimethoxychromen-4-one |
| InChI | InChI=1S/C18H16O7/c1-22-16-14(21)13-11(20)8-12(9-4-6-10(19)7-5-9)25-15(13)17(23-2)18(16)24-3/h4-8,19,21H,1-3H3 |
| InChIKey | SAMBWAJRKKEEOR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1O)C(=O)C=C(O2)C3=CC=C(C=C3)O)OC)OC |
