Home
>
Materials Science>Organic monomer of COF> 5,5'-(1,3-Phenylenebis(ethyne-2,1-diyl))bis(3-(tert-butyl)-2-hydroxybenzaldehyde)
For research use only. Not for therapeutic Use.
5,5′-(1,3-Phenylenebis(ethyne-2,1-diyl))bis(3-(tert-butyl)-2-hydroxybenzaldehyde)(Cat No.:L002977)is a complex organic compound used in materials science and advanced organic synthesis. This molecule features a 1,3-phenylene core linked by ethynyl groups to two hydroxybenzaldehyde units, each substituted with a tert-butyl group. The compound’s structure allows for strong conjugation and potential applications in the development of organic electronic materials, such as light-emitting diodes (LEDs) and photovoltaic cells. Its unique properties also make it useful in designing functional materials for molecular recognition and catalysis.
CAS Number | 943407-01-0 |
Molecular Formula | C32H30O4 |
Purity | ≥95% |
IUPAC Name | 3-tert-butyl-5-[2-[3-[2-(3-tert-butyl-5-formyl-4-hydroxyphenyl)ethynyl]phenyl]ethynyl]-2-hydroxybenzaldehyde |
InChI | InChI=1S/C32H30O4/c1-31(2,3)27-17-23(15-25(19-33)29(27)35)12-10-21-8-7-9-22(14-21)11-13-24-16-26(20-34)30(36)28(18-24)32(4,5)6/h7-9,14-20,35-36H,1-6H3 |
InChIKey | OAJNEVOHPGKMBT-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=CC(=C1O)C=O)C#CC2=CC(=CC=C2)C#CC3=CC(=C(C(=C3)C(C)(C)C)O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |