For research use only. Not for therapeutic Use.
5,5′-Bi[2-hydroxyisophthalaldehyde] (Cat.No:L004023) is a significant compound in materials science. Its distinct molecular structure incorporates two hydroxyisophthalaldehyde units, allowing for specialized reactivity. This compound is employed in the synthesis of tailored polymers and coordination complexes, with applications in various industries.
CAS Number | 286385-47-5 |
Molecular Formula | C16H10O6 |
Purity | ≥95% |
IUPAC Name | 5-(3,5-diformyl-4-hydroxyphenyl)-2-hydroxybenzene-1,3-dicarbaldehyde |
InChI | InChI=1S/C16H10O6/c17-5-11-1-9(2-12(6-18)15(11)21)10-3-13(7-19)16(22)14(4-10)8-20/h1-8,21-22H |
InChIKey | WEVNYHQPOMEBEZ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C=O)O)C=O)C2=CC(=C(C(=C2)C=O)O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |