Home
>
Materials Science>Organic ligands for MOF materials> 5,5'-(Carbonylbis(azanediyl))diisophthalic acid
For research use only. Not for therapeutic Use.
5,5′-(Carbonylbis(azanediyl))diisophthalic acid (Cat.No:L003520) is a significant compound in supramolecular chemistry. Its intricate structure contains amine groups that enable the formation of intricate networks through coordination interactions. This property renders it valuable in the development of functional materials, particularly in the realm of metal-organic frameworks (MOFs).
Catalog Number | L003520 |
CAS Number | 105699-82-9 |
Molecular Formula | C17H12N2O9 |
Purity | ≥95% |
IUPAC Name | 5-[(3,5-dicarboxyphenyl)carbamoylamino]benzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C17H12N2O9/c20-13(21)7-1-8(14(22)23)4-11(3-7)18-17(28)19-12-5-9(15(24)25)2-10(6-12)16(26)27/h1-6H,(H,20,21)(H,22,23)(H,24,25)(H,26,27)(H2,18,19,28) |
InChIKey | GDRBVHIQLGZJJP-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(=O)O)NC(=O)NC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |