For research use only. Not for therapeutic Use.
5,5′-Divinyl-2,2′-bipyridine (Cat.No:L003605) is a pivotal compound in organic synthesis. Its unique structure, featuring two vinyl groups on a bipyridine backbone, imparts distinctive reactivity. This makes it a valuable building block in the creation of specialized materials, particularly in the field of coordination chemistry and supramolecular assemblies. Its significance lies in its role as a versatile precursor for the synthesis of functionalized molecules with a range of applications in materials science.
Catalog Number | L003605 |
CAS Number | 932396-96-8 |
Molecular Formula | C14H12N2 |
Purity | ≥95% |
IUPAC Name | 5-ethenyl-2-(5-ethenylpyridin-2-yl)pyridine |
InChI | InChI=1S/C14H12N2/c1-3-11-5-7-13(15-9-11)14-8-6-12(4-2)10-16-14/h3-10H,1-2H2 |
InChIKey | RLSLVUNCQSJTCV-UHFFFAOYSA-N |
SMILES | C=CC1=CN=C(C=C1)C2=NC=C(C=C2)C=C |