For research use only. Not for therapeutic Use.
5,5′-(Hydroxyphosphoryl)diisophthalic acid is a phosphorus-containing aromatic compound featuring two isophthalic acid groups linked by a hydroxyphosphoryl group. This unique structure is particularly useful in materials science and pharmaceutical research, where it serves as a building block for synthesizing metal-organic frameworks (MOFs) and coordination polymers. Its multiple functional groups allow for versatile bonding interactions, making it valuable for applications in catalysis, drug delivery systems, and advanced materials. Its stability and functionality support diverse research and development efforts.
CAS Number | 315664-57-4 |
Molecular Formula | C16H11O10P |
Purity | ≥95% |
IUPAC Name | 5-[(3,5-dicarboxyphenyl)-hydroxyphosphoryl]benzene-1,3-dicarboxylic acid |
InChI | InChI=1S/C16H11O10P/c17-13(18)7-1-8(14(19)20)4-11(3-7)27(25,26)12-5-9(15(21)22)2-10(6-12)16(23)24/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
InChIKey | NIOQUEOMFLZFJG-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(=O)O)P(=O)(C2=CC(=CC(=C2)C(=O)O)C(=O)O)O)C(=O)O |