For research use only. Not for therapeutic Use.
5,5′-(Pyridine-2,5-diyl)diisophthalic acid (Cat.No:L003517) is a crucial compound in materials science. Its distinctive structure, incorporating both pyridine and isophthalic acid motifs, imparts unique electronic properties. This makes it valuable in the design of functional materials for applications like optoelectronics and sensors. Its versatility underscores its significance in the development of advanced materials
| Catalog Number | L003517 |
| CAS Number | 1431292-15-7 |
| Molecular Formula | C21H13NO8 |
| Purity | ≥95% |
| IUPAC Name | 5-[6-(3,5-dicarboxyphenyl)pyridin-3-yl]benzene-1,3-dicarboxylic acid |
| InChI | InChI=1S/C21H13NO8/c23-18(24)13-3-11(4-14(7-13)19(25)26)10-1-2-17(22-9-10)12-5-15(20(27)28)8-16(6-12)21(29)30/h1-9H,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | BSJOPMLLNCHGJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
