Home
>
Materials Science>Organic monomer of COF> 5,5',5'',5'''-Methanetetrayltetrakis(2-hydroxybenzaldehyde)
For research use only. Not for therapeutic Use.
5,5′,5”,5”’-Methanetetrayltetrakis(2-hydroxybenzaldehyde) (Cat.No:L003515) is a significant chemical compound with versatile applications. Its distinct tetrahedral structure and hydroxybenzaldehyde moieties render it valuable in coordination chemistry and materials science. This compound is employed as a key building block for the synthesis of various functional materials, showcasing its importance in the development of advanced compounds for applications in diverse industries.
CAS Number | 1352523-65-9 |
Molecular Formula | C29H20O8 |
Purity | ≥95% |
IUPAC Name | 2-hydroxy-5-[tris(3-formyl-4-hydroxyphenyl)methyl]benzaldehyde |
InChI | InChI=1S/C29H20O8/c30-13-17-9-21(1-5-25(17)34)29(22-2-6-26(35)18(10-22)14-31,23-3-7-27(36)19(11-23)15-32)24-4-8-28(37)20(12-24)16-33/h1-16,34-37H |
InChIKey | XLAQIJUJESBMLX-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(C2=CC(=C(C=C2)O)C=O)(C3=CC(=C(C=C3)O)C=O)C4=CC(=C(C=C4)O)C=O)C=O)O |